C17H19ClN2O3 — CID 110506062
4-chloro-N-[(E)-(4-ethoxy-3,5-dimethoxyphenyl)methylideneamino]aniline (PubChem CID 110506062) has the molecular formula C17H19ClN2O3 and a molecular weight of 334.80 g/mol. Its IUPAC name is 4-chloro-N-[(E)-(4-ethoxy-3,5-dimethoxyphenyl)methylideneamino]aniline.
| Compound Name | 4-chloro-N-[(E)-(4-ethoxy-3,5-dimethoxyphenyl)methylideneamino]aniline |
|---|---|
| PubChem CID | 110506062 |
| Molecular Formula | C17H19ClN2O3 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 4-chloro-N-[(E)-(4-ethoxy-3,5-dimethoxyphenyl)methylideneamino]aniline |
| SMILES | CCOc1c(OC)cc(/C=N/Nc2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C17H19ClN2O3/c1-4-23-17-15(21-2)9-12(10-16(17)22-3)11-19-20-14-7-5-13(18)6-8-14/h5-11,20H,4H2,1-3H3/b19-11+ |
| InChIKey | GDHDNHUVMARELV-YBFXNURJSA-N |
| XLogP | 4.20 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|