C13H11BrN4O3 — CID 135585593
5-[(2E)-2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-2-methyl-1,3-oxazole-4-carbonitrile (PubChem CID 135585593) has the molecular formula C13H11BrN4O3 and a molecular weight of 351.16 g/mol. Its IUPAC name is 5-[(2E)-2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-2-methyl-1,3-oxazole-4-carbonitrile.
| Compound Name | 5-[(2E)-2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-2-methyl-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 135585593 |
| Molecular Formula | C13H11BrN4O3 |
| Molecular Weight | 351.16 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 5-[(2E)-2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-2-methyl-1,3-oxazole-4-carbonitrile |
| SMILES | COc1cc(/C=N/Nc2oc(C)nc2C#N)cc(Br)c1O |
| InChI | InChI=1S/C13H11BrN4O3/c1-7-17-10(5-15)13(21-7)18-16-6-8-3-9(14)12(19)11(4-8)20-2/h3-4,6,18-19H,1-2H3/b16-6+ |
| InChIKey | OCHBVXGPJCBFMY-OMCISZLKSA-N |
| XLogP | 2.78 |
| TPSA | 103.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.16 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|