C17H16Br2N4O3 — CID 137172003
5-bromo-2-[(2Z)-2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile (PubChem CID 137172003) has the molecular formula C17H16Br2N4O3 and a molecular weight of 484.15 g/mol. Its IUPAC name is 5-bromo-2-[(2Z)-2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile.
| Compound Name | 5-bromo-2-[(2Z)-2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 137172003 |
| Molecular Formula | C17H16Br2N4O3 |
| Molecular Weight | 484.15 g/mol |
| Exact Mass | 481.96 |
| IUPAC Name | 5-bromo-2-[(2Z)-2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile |
| SMILES | COCc1c(Br)c(C)nc(N/N=C\c2cc(Br)c(O)c(OC)c2)c1C#N |
| InChI | InChI=1S/C17H16Br2N4O3/c1-9-15(19)12(8-25-2)11(6-20)17(22-9)23-21-7-10-4-13(18)16(24)14(5-10)26-3/h4-5,7,24H,8H2,1-3H3,(H,22,23)/b21-7- |
| InChIKey | DNBXTQQMATXCKY-YXSASFKJSA-N |
| XLogP | 4.09 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.15 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|