C16H15BrN4O2 — CID 137031249
2-bromo-6-methoxy-4-[(Z)-[(1-methylbenzimidazol-2-yl)hydrazinylidene]methyl]phenol (PubChem CID 137031249) has the molecular formula C16H15BrN4O2 and a molecular weight of 375.23 g/mol. Its IUPAC name is 2-bromo-6-methoxy-4-[(Z)-[(1-methylbenzimidazol-2-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 2-bromo-6-methoxy-4-[(Z)-[(1-methylbenzimidazol-2-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 137031249 |
| Molecular Formula | C16H15BrN4O2 |
| Molecular Weight | 375.23 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | 2-bromo-6-methoxy-4-[(Z)-[(1-methylbenzimidazol-2-yl)hydrazinylidene]methyl]phenol |
| SMILES | COc1cc(/C=N\Nc2nc3ccccc3n2C)cc(Br)c1O |
| InChI | InChI=1S/C16H15BrN4O2/c1-21-13-6-4-3-5-12(13)19-16(21)20-18-9-10-7-11(17)15(22)14(8-10)23-2/h3-9,22H,1-2H3,(H,19,20)/b18-9- |
| InChIKey | OQBQAWVGAFCPIC-NVMNQCDNSA-N |
| XLogP | 3.50 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.23 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|