C15H14N4 — CID 589673
N-(benzylideneamino)-1-methylbenzimidazol-2-amine (PubChem CID 589673) has the molecular formula C15H14N4 and a molecular weight of 250.31 g/mol. Its IUPAC name is N-(benzylideneamino)-1-methylbenzimidazol-2-amine.
| Compound Name | N-(benzylideneamino)-1-methylbenzimidazol-2-amine |
|---|---|
| PubChem CID | 589673 |
| Molecular Formula | C15H14N4 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | N-(benzylideneamino)-1-methylbenzimidazol-2-amine |
| SMILES | Cn1c(NN=Cc2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C15H14N4/c1-19-14-10-6-5-9-13(14)17-15(19)18-16-11-12-7-3-2-4-8-12/h2-11H,1H3,(H,17,18) |
| InChIKey | QPMKQSHLMNXDPB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|