C16H14Cl3NO3 — CID 5165015
N-(2,4,5-trichlorophenyl)-1-(3,4,5-trimethoxyphenyl)methanimine (PubChem CID 5165015) has the molecular formula C16H14Cl3NO3 and a molecular weight of 374.65 g/mol. Its IUPAC name is N-(2,4,5-trichlorophenyl)-1-(3,4,5-trimethoxyphenyl)methanimine.
| Compound Name | N-(2,4,5-trichlorophenyl)-1-(3,4,5-trimethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 5165015 |
| Molecular Formula | C16H14Cl3NO3 |
| Molecular Weight | 374.65 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | N-(2,4,5-trichlorophenyl)-1-(3,4,5-trimethoxyphenyl)methanimine |
| SMILES | COc1cc(/C=N/c2cc(Cl)c(Cl)cc2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C16H14Cl3NO3/c1-21-14-4-9(5-15(22-2)16(14)23-3)8-20-13-7-11(18)10(17)6-12(13)19/h4-8H,1-3H3/b20-8+ |
| InChIKey | UDSPHJPPKOWBLA-DNTJNYDQSA-N |
| XLogP | 5.42 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.65 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|