C26H26Cl2N4O4 — CID 20517401
N-[4-[[2,5-dichloro-4-(dimethylaminomethylideneamino)phenyl]iminomethyl]phenyl]-3,4,5-trimethoxybenzamide (PubChem CID 20517401) has the molecular formula C26H26Cl2N4O4 and a molecular weight of 529.42 g/mol. Its IUPAC name is N-[4-[[2,5-dichloro-4-(dimethylaminomethylideneamino)phenyl]iminomethyl]phenyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[4-[[2,5-dichloro-4-(dimethylaminomethylideneamino)phenyl]iminomethyl]phenyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 20517401 |
| Molecular Formula | C26H26Cl2N4O4 |
| Molecular Weight | 529.42 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | N-[4-[[2,5-dichloro-4-(dimethylaminomethylideneamino)phenyl]iminomethyl]phenyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(/C=N/c3cc(Cl)c(/N=C/N(C)C)cc3Cl)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C26H26Cl2N4O4/c1-32(2)15-30-22-13-19(27)21(12-20(22)28)29-14-16-6-8-18(9-7-16)31-26(33)17-10-23(34-3)25(36-5)24(11-17)35-4/h6-15H,1-5H3,(H,31,33)/b29-14+,30-15+ |
| InChIKey | VMYWFBKFKSFPHS-VMTVTTGYSA-N |
| XLogP | 6.24 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.42 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|