C21H29N3O4 — CID 112981526
N-[4-[3-(dimethylamino)propylamino]phenyl]-3,4,5-trimethoxybenzamide (PubChem CID 112981526) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is N-[4-[3-(dimethylamino)propylamino]phenyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[4-[3-(dimethylamino)propylamino]phenyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 112981526 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | N-[4-[3-(dimethylamino)propylamino]phenyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(NCCCN(C)C)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C21H29N3O4/c1-24(2)12-6-11-22-16-7-9-17(10-8-16)23-21(25)15-13-18(26-3)20(28-5)19(14-15)27-4/h7-10,13-14,22H,6,11-12H2,1-5H3,(H,23,25) |
| InChIKey | ATAUUESNKOJFMO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|