C20H27N3O3 — CID 112981519
N-[4-[3-(dimethylamino)propylamino]phenyl]-3,5-dimethoxybenzamide (PubChem CID 112981519) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is N-[4-[3-(dimethylamino)propylamino]phenyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[4-[3-(dimethylamino)propylamino]phenyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 112981519 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | N-[4-[3-(dimethylamino)propylamino]phenyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2ccc(NCCCN(C)C)cc2)c1 |
| InChI | InChI=1S/C20H27N3O3/c1-23(2)11-5-10-21-16-6-8-17(9-7-16)22-20(24)15-12-18(25-3)14-19(13-15)26-4/h6-9,12-14,21H,5,10-11H2,1-4H3,(H,22,24) |
| InChIKey | WSGJBNRFAPKVSA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|