C22H21FN2O3 — CID 112982463
N-[4-[(4-fluorophenyl)methylamino]phenyl]-3,5-dimethoxybenzamide (PubChem CID 112982463) has the molecular formula C22H21FN2O3 and a molecular weight of 380.42 g/mol. Its IUPAC name is N-[4-[(4-fluorophenyl)methylamino]phenyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[4-[(4-fluorophenyl)methylamino]phenyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 112982463 |
| Molecular Formula | C22H21FN2O3 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | N-[4-[(4-fluorophenyl)methylamino]phenyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2ccc(NCc3ccc(F)cc3)cc2)c1 |
| InChI | InChI=1S/C22H21FN2O3/c1-27-20-11-16(12-21(13-20)28-2)22(26)25-19-9-7-18(8-10-19)24-14-15-3-5-17(23)6-4-15/h3-13,24H,14H2,1-2H3,(H,25,26) |
| InChIKey | UPLBCLZTZCHZMH-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |