C16H15F2NO3 — CID 2358363
N-(2,5-difluorophenyl)-1-(3,4,5-trimethoxyphenyl)methanimine (PubChem CID 2358363) has the molecular formula C16H15F2NO3 and a molecular weight of 307.30 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-1-(3,4,5-trimethoxyphenyl)methanimine.
| Compound Name | N-(2,5-difluorophenyl)-1-(3,4,5-trimethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 2358363 |
| Molecular Formula | C16H15F2NO3 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N-(2,5-difluorophenyl)-1-(3,4,5-trimethoxyphenyl)methanimine |
| SMILES | COc1cc(/C=N/c2cc(F)ccc2F)cc(OC)c1OC |
| InChI | InChI=1S/C16H15F2NO3/c1-20-14-6-10(7-15(21-2)16(14)22-3)9-19-13-8-11(17)4-5-12(13)18/h4-9H,1-3H3/b19-9+ |
| InChIKey | QEQJTRGOULLCPK-DJKKODMXSA-N |
| XLogP | 3.74 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|