C21H15Cl4NO2 — CID 23738779
1-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-N-(2,4,5-trichlorophenyl)methanimine (PubChem CID 23738779) has the molecular formula C21H15Cl4NO2 and a molecular weight of 455.17 g/mol. Its IUPAC name is 1-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-N-(2,4,5-trichlorophenyl)methanimine.
| Compound Name | 1-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-N-(2,4,5-trichlorophenyl)methanimine |
|---|---|
| PubChem CID | 23738779 |
| Molecular Formula | C21H15Cl4NO2 |
| Molecular Weight | 455.17 g/mol |
| Exact Mass | 452.99 |
| IUPAC Name | 1-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-N-(2,4,5-trichlorophenyl)methanimine |
| SMILES | COc1cc(/C=N/c2cc(Cl)c(Cl)cc2Cl)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H15Cl4NO2/c1-27-21-8-14(11-26-19-10-17(24)16(23)9-18(19)25)4-7-20(21)28-12-13-2-5-15(22)6-3-13/h2-11H,12H2,1H3/b26-11+ |
| InChIKey | YCNLWUQLQSQRHM-KBKYJPHKSA-N |
| XLogP | 7.64 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.17 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|