C14H16ClN5O3 — CID 87019889
N-[(3-chlorophenyl)methyl]-2-(3-nitro-1,2,4-triazol-1-yl)-N-propan-2-ylacetamide (PubChem CID 87019889) has the molecular formula C14H16ClN5O3 and a molecular weight of 337.77 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-2-(3-nitro-1,2,4-triazol-1-yl)-N-propan-2-ylacetamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-2-(3-nitro-1,2,4-triazol-1-yl)-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 87019889 |
| Molecular Formula | C14H16ClN5O3 |
| Molecular Weight | 337.77 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-2-(3-nitro-1,2,4-triazol-1-yl)-N-propan-2-ylacetamide |
| SMILES | CC(C)N(Cc1cccc(Cl)c1)C(=O)Cn1cnc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C14H16ClN5O3/c1-10(2)19(7-11-4-3-5-12(15)6-11)13(21)8-18-9-16-14(17-18)20(22)23/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | SLZNQZRHOAGFRA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 94.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.77 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|