C23H17N3O3 — CID 5338217
N-[(E)-anthracen-9-ylmethylideneamino]-2-(4-nitrophenyl)acetamide (PubChem CID 5338217) has the molecular formula C23H17N3O3 and a molecular weight of 383.41 g/mol. Its IUPAC name is N-[(E)-anthracen-9-ylmethylideneamino]-2-(4-nitrophenyl)acetamide.
| Compound Name | N-[(E)-anthracen-9-ylmethylideneamino]-2-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 5338217 |
| Molecular Formula | C23H17N3O3 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | N-[(E)-anthracen-9-ylmethylideneamino]-2-(4-nitrophenyl)acetamide |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)N/N=C/c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C23H17N3O3/c27-23(13-16-9-11-19(12-10-16)26(28)29)25-24-15-22-20-7-3-1-5-17(20)14-18-6-2-4-8-21(18)22/h1-12,14-15H,13H2,(H,25,27)/b24-15+ |
| InChIKey | FOMNFCASZRXNQF-BUVRLJJBSA-N |
| XLogP | 4.59 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|