C11H9N7O6 — CID 135682502
N-[(Z)-(2-hydroxy-5-nitrophenyl)methylideneamino]-2-(3-nitro-1,2,4-triazol-1-yl)acetamide (PubChem CID 135682502) has the molecular formula C11H9N7O6 and a molecular weight of 335.24 g/mol. Its IUPAC name is N-[(Z)-(2-hydroxy-5-nitrophenyl)methylideneamino]-2-(3-nitro-1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-[(Z)-(2-hydroxy-5-nitrophenyl)methylideneamino]-2-(3-nitro-1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 135682502 |
| Molecular Formula | C11H9N7O6 |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | N-[(Z)-(2-hydroxy-5-nitrophenyl)methylideneamino]-2-(3-nitro-1,2,4-triazol-1-yl)acetamide |
| SMILES | O=C(Cn1cnc([N+](=O)[O-])n1)N/N=C\c1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C11H9N7O6/c19-9-2-1-8(17(21)22)3-7(9)4-13-14-10(20)5-16-6-12-11(15-16)18(23)24/h1-4,6,19H,5H2,(H,14,20)/b13-4- |
| InChIKey | YGDJCLKJFONKNU-PQMHYQBVSA-N |
| XLogP | -0.05 |
| TPSA | 178.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|