C13H12N8O3 — CID 674613
N-[1-(5-nitrotetrazol-2-yl)propan-2-ylideneamino]-1H-indole-3-carboxamide (PubChem CID 674613) has the molecular formula C13H12N8O3 and a molecular weight of 328.29 g/mol. Its IUPAC name is N-[1-(5-nitrotetrazol-2-yl)propan-2-ylideneamino]-1H-indole-3-carboxamide.
| Compound Name | N-[1-(5-nitrotetrazol-2-yl)propan-2-ylideneamino]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 674613 |
| Molecular Formula | C13H12N8O3 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | N-[1-(5-nitrotetrazol-2-yl)propan-2-ylideneamino]-1H-indole-3-carboxamide |
| SMILES | CC(Cn1nnc([N+](=O)[O-])n1)=NNC(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C13H12N8O3/c1-8(7-20-18-13(17-19-20)21(23)24)15-16-12(22)10-6-14-11-5-3-2-4-9(10)11/h2-6,14H,7H2,1H3,(H,16,22) |
| InChIKey | GQSAVLJZPDPNGO-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 143.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|