C11H11N7O4 — CID 6326556
4-hydroxy-N-[(Z)-1-(5-nitrotetrazol-2-yl)propan-2-ylideneamino]benzamide (PubChem CID 6326556) has the molecular formula C11H11N7O4 and a molecular weight of 305.25 g/mol. Its IUPAC name is 4-hydroxy-N-[(Z)-1-(5-nitrotetrazol-2-yl)propan-2-ylideneamino]benzamide.
| Compound Name | 4-hydroxy-N-[(Z)-1-(5-nitrotetrazol-2-yl)propan-2-ylideneamino]benzamide |
|---|---|
| PubChem CID | 6326556 |
| Molecular Formula | C11H11N7O4 |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 4-hydroxy-N-[(Z)-1-(5-nitrotetrazol-2-yl)propan-2-ylideneamino]benzamide |
| SMILES | C/C(Cn1nnc([N+](=O)[O-])n1)=N/NC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C11H11N7O4/c1-7(6-17-15-11(14-16-17)18(21)22)12-13-10(20)8-2-4-9(19)5-3-8/h2-5,19H,6H2,1H3,(H,13,20)/b12-7- |
| InChIKey | XZAYZAQTAXJVOT-GHXNOFRVSA-N |
| XLogP | 0.09 |
| TPSA | 148.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|