C20H22N4O7 — CID 3703060
3,5-dimethoxy-N-[[4-(4-methoxy-2-nitroanilino)-4-oxobutan-2-ylidene]amino]benzamide (PubChem CID 3703060) has the molecular formula C20H22N4O7 and a molecular weight of 430.42 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[[4-(4-methoxy-2-nitroanilino)-4-oxobutan-2-ylidene]amino]benzamide.
| Compound Name | 3,5-dimethoxy-N-[[4-(4-methoxy-2-nitroanilino)-4-oxobutan-2-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 3703060 |
| Molecular Formula | C20H22N4O7 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 3,5-dimethoxy-N-[[4-(4-methoxy-2-nitroanilino)-4-oxobutan-2-ylidene]amino]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)NN=C(C)CC(=O)Nc2ccc(OC)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H22N4O7/c1-12(22-23-20(26)13-8-15(30-3)10-16(9-13)31-4)7-19(25)21-17-6-5-14(29-2)11-18(17)24(27)28/h5-6,8-11H,7H2,1-4H3,(H,21,25)(H,23,26) |
| InChIKey | CIUXKXCPFOTTLX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 141.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|