C18H17ClN4O5 — CID 171979108
3-chloro-N-[(E)-[4-(2-methoxyanilino)-4-oxobutan-2-ylidene]amino]-4-nitrobenzamide (PubChem CID 171979108) has the molecular formula C18H17ClN4O5 and a molecular weight of 404.81 g/mol. Its IUPAC name is 3-chloro-N-[(E)-[4-(2-methoxyanilino)-4-oxobutan-2-ylidene]amino]-4-nitrobenzamide.
| Compound Name | 3-chloro-N-[(E)-[4-(2-methoxyanilino)-4-oxobutan-2-ylidene]amino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 171979108 |
| Molecular Formula | C18H17ClN4O5 |
| Molecular Weight | 404.81 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 3-chloro-N-[(E)-[4-(2-methoxyanilino)-4-oxobutan-2-ylidene]amino]-4-nitrobenzamide |
| SMILES | COc1ccccc1NC(=O)C/C(C)=N/NC(=O)c1ccc([N+](=O)[O-])c(Cl)c1 |
| InChI | InChI=1S/C18H17ClN4O5/c1-11(9-17(24)20-14-5-3-4-6-16(14)28-2)21-22-18(25)12-7-8-15(23(26)27)13(19)10-12/h3-8,10H,9H2,1-2H3,(H,20,24)(H,22,25)/b21-11+ |
| InChIKey | NFZPEUQPAVFEPS-SRZZPIQSSA-N |
| XLogP | 3.39 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.81 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|