C21H23ClN4O6 — CID 51064209
3-chloro-N-[(E)-[4-[2-(3,4-dimethoxyphenyl)ethylamino]-4-oxobutan-2-ylidene]amino]-4-nitrobenzamide (PubChem CID 51064209) has the molecular formula C21H23ClN4O6 and a molecular weight of 462.89 g/mol. Its IUPAC name is 3-chloro-N-[(E)-[4-[2-(3,4-dimethoxyphenyl)ethylamino]-4-oxobutan-2-ylidene]amino]-4-nitrobenzamide.
| Compound Name | 3-chloro-N-[(E)-[4-[2-(3,4-dimethoxyphenyl)ethylamino]-4-oxobutan-2-ylidene]amino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 51064209 |
| Molecular Formula | C21H23ClN4O6 |
| Molecular Weight | 462.89 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 3-chloro-N-[(E)-[4-[2-(3,4-dimethoxyphenyl)ethylamino]-4-oxobutan-2-ylidene]amino]-4-nitrobenzamide |
| SMILES | COc1ccc(CCNC(=O)C/C(C)=N/NC(=O)c2ccc([N+](=O)[O-])c(Cl)c2)cc1OC |
| InChI | InChI=1S/C21H23ClN4O6/c1-13(24-25-21(28)15-5-6-17(26(29)30)16(22)12-15)10-20(27)23-9-8-14-4-7-18(31-2)19(11-14)32-3/h4-7,11-12H,8-10H2,1-3H3,(H,23,27)(H,25,28)/b24-13+ |
| InChIKey | NCNJIMQJKXZCFC-ZMOGYAJESA-N |
| XLogP | 3.12 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.89 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|