C18H16Cl2N4O4 — CID 46501890
3-chloro-N-[(Z)-[4-[(4-chlorophenyl)methylamino]-4-oxobutan-2-ylidene]amino]-4-nitrobenzamide (PubChem CID 46501890) has the molecular formula C18H16Cl2N4O4 and a molecular weight of 423.26 g/mol. Its IUPAC name is 3-chloro-N-[(Z)-[4-[(4-chlorophenyl)methylamino]-4-oxobutan-2-ylidene]amino]-4-nitrobenzamide.
| Compound Name | 3-chloro-N-[(Z)-[4-[(4-chlorophenyl)methylamino]-4-oxobutan-2-ylidene]amino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 46501890 |
| Molecular Formula | C18H16Cl2N4O4 |
| Molecular Weight | 423.26 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | 3-chloro-N-[(Z)-[4-[(4-chlorophenyl)methylamino]-4-oxobutan-2-ylidene]amino]-4-nitrobenzamide |
| SMILES | C/C(CC(=O)NCc1ccc(Cl)cc1)=N/NC(=O)c1ccc([N+](=O)[O-])c(Cl)c1 |
| InChI | InChI=1S/C18H16Cl2N4O4/c1-11(8-17(25)21-10-12-2-5-14(19)6-3-12)22-23-18(26)13-4-7-16(24(27)28)15(20)9-13/h2-7,9H,8,10H2,1H3,(H,21,25)(H,23,26)/b22-11- |
| InChIKey | AGLLVDCPWYGZMA-JJFYIABZSA-N |
| XLogP | 3.71 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.26 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|