C21H17ClN4O4 — CID 98155821
3-chloro-N-[(Z)-[4-(naphthalen-2-ylamino)-4-oxobutan-2-ylidene]amino]-4-nitrobenzamide (PubChem CID 98155821) has the molecular formula C21H17ClN4O4 and a molecular weight of 424.84 g/mol. Its IUPAC name is 3-chloro-N-[(Z)-[4-(naphthalen-2-ylamino)-4-oxobutan-2-ylidene]amino]-4-nitrobenzamide.
| Compound Name | 3-chloro-N-[(Z)-[4-(naphthalen-2-ylamino)-4-oxobutan-2-ylidene]amino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 98155821 |
| Molecular Formula | C21H17ClN4O4 |
| Molecular Weight | 424.84 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 3-chloro-N-[(Z)-[4-(naphthalen-2-ylamino)-4-oxobutan-2-ylidene]amino]-4-nitrobenzamide |
| SMILES | C/C(CC(=O)Nc1ccc2ccccc2c1)=N/NC(=O)c1ccc([N+](=O)[O-])c(Cl)c1 |
| InChI | InChI=1S/C21H17ClN4O4/c1-13(24-25-21(28)16-7-9-19(26(29)30)18(22)12-16)10-20(27)23-17-8-6-14-4-2-3-5-15(14)11-17/h2-9,11-12H,10H2,1H3,(H,23,27)(H,25,28)/b24-13- |
| InChIKey | MBQGHHQPZFWTEO-CFRMEGHHSA-N |
| XLogP | 4.54 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.84 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|