C17H13Cl3N4O4 — CID 16760917
3-chloro-N-[(E)-[4-(2,4-dichloroanilino)-4-oxobutan-2-ylidene]amino]-4-nitrobenzamide (PubChem CID 16760917) has the molecular formula C17H13Cl3N4O4 and a molecular weight of 443.67 g/mol. Its IUPAC name is 3-chloro-N-[(E)-[4-(2,4-dichloroanilino)-4-oxobutan-2-ylidene]amino]-4-nitrobenzamide.
| Compound Name | 3-chloro-N-[(E)-[4-(2,4-dichloroanilino)-4-oxobutan-2-ylidene]amino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 16760917 |
| Molecular Formula | C17H13Cl3N4O4 |
| Molecular Weight | 443.67 g/mol |
| Exact Mass | 442.00 |
| IUPAC Name | 3-chloro-N-[(E)-[4-(2,4-dichloroanilino)-4-oxobutan-2-ylidene]amino]-4-nitrobenzamide |
| SMILES | C/C(CC(=O)Nc1ccc(Cl)cc1Cl)=N\NC(=O)c1ccc([N+](=O)[O-])c(Cl)c1 |
| InChI | InChI=1S/C17H13Cl3N4O4/c1-9(6-16(25)21-14-4-3-11(18)8-12(14)19)22-23-17(26)10-2-5-15(24(27)28)13(20)7-10/h2-5,7-8H,6H2,1H3,(H,21,25)(H,23,26)/b22-9+ |
| InChIKey | MHWXZTCLMWRDAT-LSFURLLWSA-N |
| XLogP | 4.69 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.67 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|