C17H14ClIN4O4 — CID 46501897
3-chloro-N-[(E)-[4-(4-iodoanilino)-4-oxobutan-2-ylidene]amino]-4-nitrobenzamide (PubChem CID 46501897) has the molecular formula C17H14ClIN4O4 and a molecular weight of 500.68 g/mol. Its IUPAC name is 3-chloro-N-[(E)-[4-(4-iodoanilino)-4-oxobutan-2-ylidene]amino]-4-nitrobenzamide.
| Compound Name | 3-chloro-N-[(E)-[4-(4-iodoanilino)-4-oxobutan-2-ylidene]amino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 46501897 |
| Molecular Formula | C17H14ClIN4O4 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 499.97 |
| IUPAC Name | 3-chloro-N-[(E)-[4-(4-iodoanilino)-4-oxobutan-2-ylidene]amino]-4-nitrobenzamide |
| SMILES | C/C(CC(=O)Nc1ccc(I)cc1)=N\NC(=O)c1ccc([N+](=O)[O-])c(Cl)c1 |
| InChI | InChI=1S/C17H14ClIN4O4/c1-10(8-16(24)20-13-5-3-12(19)4-6-13)21-22-17(25)11-2-7-15(23(26)27)14(18)9-11/h2-7,9H,8H2,1H3,(H,20,24)(H,22,25)/b21-10+ |
| InChIKey | PRQDNPNFOYDWFJ-UFFVCSGVSA-N |
| XLogP | 3.99 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|