C18H16ClN5O5 — CID 6154320
N-[(Z)-[4-(4-carbamoylanilino)-4-oxobutan-2-ylidene]amino]-3-chloro-4-nitrobenzamide (PubChem CID 6154320) has the molecular formula C18H16ClN5O5 and a molecular weight of 417.81 g/mol. Its IUPAC name is N-[(Z)-[4-(4-carbamoylanilino)-4-oxobutan-2-ylidene]amino]-3-chloro-4-nitrobenzamide.
| Compound Name | N-[(Z)-[4-(4-carbamoylanilino)-4-oxobutan-2-ylidene]amino]-3-chloro-4-nitrobenzamide |
|---|---|
| PubChem CID | 6154320 |
| Molecular Formula | C18H16ClN5O5 |
| Molecular Weight | 417.81 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | N-[(Z)-[4-(4-carbamoylanilino)-4-oxobutan-2-ylidene]amino]-3-chloro-4-nitrobenzamide |
| SMILES | C/C(CC(=O)Nc1ccc(C(N)=O)cc1)=N/NC(=O)c1ccc([N+](=O)[O-])c(Cl)c1 |
| InChI | InChI=1S/C18H16ClN5O5/c1-10(8-16(25)21-13-5-2-11(3-6-13)17(20)26)22-23-18(27)12-4-7-15(24(28)29)14(19)9-12/h2-7,9H,8H2,1H3,(H2,20,26)(H,21,25)(H,23,27)/b22-10- |
| InChIKey | WOQSSTKSQYNWHO-YVNNLAQVSA-N |
| XLogP | 2.48 |
| TPSA | 156.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.81 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|