C24H23BrClN3O2 — CID 18833539
[(E)-[1-(4-bromophenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-ylidene]amino] N-(4-chlorophenyl)carbamate (PubChem CID 18833539) has the molecular formula C24H23BrClN3O2 and a molecular weight of 500.82 g/mol. Its IUPAC name is [(E)-[1-(4-bromophenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-ylidene]amino] N-(4-chlorophenyl)carbamate.
| Compound Name | [(E)-[1-(4-bromophenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-ylidene]amino] N-(4-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 18833539 |
| Molecular Formula | C24H23BrClN3O2 |
| Molecular Weight | 500.82 g/mol |
| Exact Mass | 499.07 |
| IUPAC Name | [(E)-[1-(4-bromophenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-ylidene]amino] N-(4-chlorophenyl)carbamate |
| SMILES | Cc1cc2c(n1-c1ccc(Br)cc1)CC(C)(C)C/C2=N\OC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H23BrClN3O2/c1-15-12-20-21(28-31-23(30)27-18-8-6-17(26)7-9-18)13-24(2,3)14-22(20)29(15)19-10-4-16(25)5-11-19/h4-12H,13-14H2,1-3H3,(H,27,30)/b28-21+ |
| InChIKey | LDBZMEHVNYVISD-SGWCAAJKSA-N |
| XLogP | 7.13 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.82 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|