C17H17Cl2NO — CID 3247774
1-(3,4-dichlorophenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-one (PubChem CID 3247774) has the molecular formula C17H17Cl2NO and a molecular weight of 322.24 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-one.
| Compound Name | 1-(3,4-dichlorophenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-one |
|---|---|
| PubChem CID | 3247774 |
| Molecular Formula | C17H17Cl2NO |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-one |
| SMILES | Cc1cc2c(n1-c1ccc(Cl)c(Cl)c1)CC(C)(C)CC2=O |
| InChI | InChI=1S/C17H17Cl2NO/c1-10-6-12-15(8-17(2,3)9-16(12)21)20(10)11-4-5-13(18)14(19)7-11/h4-7H,8-9H2,1-3H3 |
| InChIKey | IWKWYDLQHNFZFK-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|