C17H17ClINO — CID 107605981
1-(2-chloro-4-iodophenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-one (PubChem CID 107605981) has the molecular formula C17H17ClINO and a molecular weight of 413.69 g/mol. Its IUPAC name is 1-(2-chloro-4-iodophenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-one.
| Compound Name | 1-(2-chloro-4-iodophenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-one |
|---|---|
| PubChem CID | 107605981 |
| Molecular Formula | C17H17ClINO |
| Molecular Weight | 413.69 g/mol |
| Exact Mass | 413.00 |
| IUPAC Name | 1-(2-chloro-4-iodophenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-one |
| SMILES | Cc1cc2c(n1-c1ccc(I)cc1Cl)CC(C)(C)CC2=O |
| InChI | InChI=1S/C17H17ClINO/c1-10-6-12-15(8-17(2,3)9-16(12)21)20(10)14-5-4-11(19)7-13(14)18/h4-7H,8-9H2,1-3H3 |
| InChIKey | RQOLACZOVABMKN-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.69 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|