C16H20N4O — CID 114389225
1-(5,6-dimethyl-1,2,4-triazin-3-yl)-2,6,6-trimethyl-5,7-dihydroindol-4-one (PubChem CID 114389225) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is 1-(5,6-dimethyl-1,2,4-triazin-3-yl)-2,6,6-trimethyl-5,7-dihydroindol-4-one.
| Compound Name | 1-(5,6-dimethyl-1,2,4-triazin-3-yl)-2,6,6-trimethyl-5,7-dihydroindol-4-one |
|---|---|
| PubChem CID | 114389225 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 1-(5,6-dimethyl-1,2,4-triazin-3-yl)-2,6,6-trimethyl-5,7-dihydroindol-4-one |
| SMILES | Cc1nnc(-n2c(C)cc3c2CC(C)(C)CC3=O)nc1C |
| InChI | InChI=1S/C16H20N4O/c1-9-6-12-13(7-16(4,5)8-14(12)21)20(9)15-17-10(2)11(3)18-19-15/h6H,7-8H2,1-5H3 |
| InChIKey | ZOFBYGKSRAOQEE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |