C13H15N3OS — CID 107649034
2,6,6-trimethyl-1-(thiadiazol-5-yl)-5,7-dihydroindol-4-one (PubChem CID 107649034) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is 2,6,6-trimethyl-1-(thiadiazol-5-yl)-5,7-dihydroindol-4-one.
| Compound Name | 2,6,6-trimethyl-1-(thiadiazol-5-yl)-5,7-dihydroindol-4-one |
|---|---|
| PubChem CID | 107649034 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 2,6,6-trimethyl-1-(thiadiazol-5-yl)-5,7-dihydroindol-4-one |
| SMILES | Cc1cc2c(n1-c1cnns1)CC(C)(C)CC2=O |
| InChI | InChI=1S/C13H15N3OS/c1-8-4-9-10(5-13(2,3)6-11(9)17)16(8)12-7-14-15-18-12/h4,7H,5-6H2,1-3H3 |
| InChIKey | SSKFFLPLQABOTK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |