C19H23N3O2 — CID 90790143
N'-hydroxy-3-methyl-4-(2,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzenecarboximidamide (PubChem CID 90790143) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is N'-hydroxy-3-methyl-4-(2,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzenecarboximidamide.
| Compound Name | N'-hydroxy-3-methyl-4-(2,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 90790143 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | N'-hydroxy-3-methyl-4-(2,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzenecarboximidamide |
| SMILES | Cc1cc(C(N)=NO)ccc1-n1c(C)cc2c1CC(C)(C)CC2=O |
| InChI | InChI=1S/C19H23N3O2/c1-11-7-13(18(20)21-24)5-6-15(11)22-12(2)8-14-16(22)9-19(3,4)10-17(14)23/h5-8,24H,9-10H2,1-4H3,(H2,20,21) |
| InChIKey | XIBMXCDPCCEZNG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 80.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|