C19H23NO — CID 63465689
1-(3-ethylphenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-one (PubChem CID 63465689) has the molecular formula C19H23NO and a molecular weight of 281.40 g/mol. Its IUPAC name is 1-(3-ethylphenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-one.
| Compound Name | 1-(3-ethylphenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-one |
|---|---|
| PubChem CID | 63465689 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 1-(3-ethylphenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-one |
| SMILES | CCc1cccc(-n2c(C)cc3c2CC(C)(C)CC3=O)c1 |
| InChI | InChI=1S/C19H23NO/c1-5-14-7-6-8-15(10-14)20-13(2)9-16-17(20)11-19(3,4)12-18(16)21/h6-10H,5,11-12H2,1-4H3 |
| InChIKey | DMUVLKJUCLEKEK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|