C28H33ClN2O3 — CID 18833508
[(E)-[1-(4-chlorophenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-ylidene]amino] 4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 18833508) has the molecular formula C28H33ClN2O3 and a molecular weight of 481.04 g/mol. Its IUPAC name is [(E)-[1-(4-chlorophenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-ylidene]amino] 4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxylate.
| Compound Name | [(E)-[1-(4-chlorophenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-ylidene]amino] 4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxylate |
|---|---|
| PubChem CID | 18833508 |
| Molecular Formula | C28H33ClN2O3 |
| Molecular Weight | 481.04 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | [(E)-[1-(4-chlorophenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-ylidene]amino] 4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | Cc1cc2c(n1-c1ccc(Cl)cc1)CC(C)(C)C/C2=N\OC(=O)C12CCC(C)(C(=O)C1)C2(C)C |
| InChI | InChI=1S/C28H33ClN2O3/c1-17-13-20-21(14-25(2,3)15-22(20)31(17)19-9-7-18(29)8-10-19)30-34-24(33)28-12-11-27(6,23(32)16-28)26(28,4)5/h7-10,13H,11-12,14-16H2,1-6H3/b30-21+ |
| InChIKey | NWKYSDPGOGDTKY-MWAVMZGNSA-N |
| XLogP | 6.44 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.04 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|