C22H29N3O2 — CID 87213174
4-[(4Z)-2,6,6-trimethyl-4-(2-methylpropoxyimino)-5,7-dihydroindol-1-yl]benzamide (PubChem CID 87213174) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is 4-[(4Z)-2,6,6-trimethyl-4-(2-methylpropoxyimino)-5,7-dihydroindol-1-yl]benzamide.
| Compound Name | 4-[(4Z)-2,6,6-trimethyl-4-(2-methylpropoxyimino)-5,7-dihydroindol-1-yl]benzamide |
|---|---|
| PubChem CID | 87213174 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 4-[(4Z)-2,6,6-trimethyl-4-(2-methylpropoxyimino)-5,7-dihydroindol-1-yl]benzamide |
| SMILES | Cc1cc2c(n1-c1ccc(C(N)=O)cc1)CC(C)(C)C/C2=N/OCC(C)C |
| InChI | InChI=1S/C22H29N3O2/c1-14(2)13-27-24-19-11-22(4,5)12-20-18(19)10-15(3)25(20)17-8-6-16(7-9-17)21(23)26/h6-10,14H,11-13H2,1-5H3,(H2,23,26)/b24-19- |
| InChIKey | BTPXAURCGVHWRN-CLCOLTQESA-N |
| XLogP | 4.23 |
| TPSA | 69.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|