About (fluoren-9-ylideneamino) N-(4-methoxyphenyl)carbamate
(fluoren-9-ylideneamino) N-(4-methoxyphenyl)carbamate (PubChem CID 748240) has the molecular formula C21H16N2O3
and a molecular weight of 344.37 g/mol. Its IUPAC name is (fluoren-9-ylideneamino) N-(4-methoxyphenyl)carbamate.
Molecular Properties
| Compound Name | (fluoren-9-ylideneamino) N-(4-methoxyphenyl)carbamate |
| PubChem CID | 748240 |
| Molecular Formula | C21H16N2O3 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | (fluoren-9-ylideneamino) N-(4-methoxyphenyl)carbamate |
| SMILES | COc1ccc(NC(=O)ON=C2c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C21H16N2O3/c1-25-15-12-10-14(11-13-15)22-21(24)26-23-20-18-8-4-2-6-16(18)17-7-3-5-9-19(17)20/h2-13H,1H3,(H,22,24) |
| InChIKey | MCEKMHPPYCOROC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (fluoren-9-ylideneamino) N-(4-methoxyphenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (fluoren-9-ylideneamino) N-(4-methoxyphenyl)carbamate?
The IUPAC name of (fluoren-9-ylideneamino) N-(4-methoxyphenyl)carbamate (CID 748240) is (fluoren-9-ylideneamino) N-(4-methoxyphenyl)carbamate.
What is the SMILES notation for (fluoren-9-ylideneamino) N-(4-methoxyphenyl)carbamate?
The canonical SMILES for (fluoren-9-ylideneamino) N-(4-methoxyphenyl)carbamate is COc1ccc(NC(=O)ON=C2c3ccccc3-c3ccccc32)cc1.
What is the InChIKey of (fluoren-9-ylideneamino) N-(4-methoxyphenyl)carbamate?
The InChIKey is MCEKMHPPYCOROC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N2O3/c1-25-15-12-10-14(11-13-15)22-21(24)26-23-20-18-8-4-2-6-16(18)17-7-3-5-9-19(17)20/h2-13H,1H3,(H,22,24).
What are the key properties of (fluoren-9-ylideneamino) N-(4-methoxyphenyl)carbamate?
(fluoren-9-ylideneamino) N-(4-methoxyphenyl)carbamate has a molecular weight of 344.37 g/mol, XLogP of 4.68, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (fluoren-9-ylideneamino) N-(4-methoxyphenyl)carbamate is sourced from PubChem (CID 748240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).