About hydron;1-phenylanthracene
hydron;1-phenylanthracene (PubChem CID 174351162) has the molecular formula C20H15+
and a molecular weight of 255.34 g/mol. Its IUPAC name is hydron;1-phenylanthracene.
Molecular Properties
| Compound Name | hydron;1-phenylanthracene |
| PubChem CID | 174351162 |
| Molecular Formula | C20H15+ |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | hydron;1-phenylanthracene |
| SMILES | [H+].c1ccc(-c2cccc3cc4ccccc4cc23)cc1 |
| InChI | InChI=1S/C20H14/c1-2-7-15(8-3-1)19-12-6-11-18-13-16-9-4-5-10-17(16)14-20(18)19/h1-14H/p+1 |
| InChIKey | BRSRUYVJULRMRQ-UHFFFAOYSA-O |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze hydron;1-phenylanthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;1-phenylanthracene?
The IUPAC name of hydron;1-phenylanthracene (CID 174351162) is hydron;1-phenylanthracene.
What is the SMILES notation for hydron;1-phenylanthracene?
The canonical SMILES for hydron;1-phenylanthracene is [H+].c1ccc(-c2cccc3cc4ccccc4cc23)cc1.
What is the InChIKey of hydron;1-phenylanthracene?
The InChIKey is BRSRUYVJULRMRQ-UHFFFAOYSA-O. The full InChI is InChI=1S/C20H14/c1-2-7-15(8-3-1)19-12-6-11-18-13-16-9-4-5-10-17(16)14-20(18)19/h1-14H/p+1.
What are the key properties of hydron;1-phenylanthracene?
hydron;1-phenylanthracene has a molecular weight of 255.34 g/mol, XLogP of 5.77, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;1-phenylanthracene is sourced from PubChem (CID 174351162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).