C16H14N2 — CID 70378591
5-phenylnaphthalene-2,3-diamine (PubChem CID 70378591) has the molecular formula C16H14N2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 5-phenylnaphthalene-2,3-diamine.
| Compound Name | 5-phenylnaphthalene-2,3-diamine |
|---|---|
| PubChem CID | 70378591 |
| Molecular Formula | C16H14N2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 5-phenylnaphthalene-2,3-diamine |
| SMILES | Nc1cc2cccc(-c3ccccc3)c2cc1N |
| InChI | InChI=1S/C16H14N2/c17-15-9-12-7-4-8-13(14(12)10-16(15)18)11-5-2-1-3-6-11/h1-10H,17-18H2 |
| InChIKey | AWCYWYXYGCNCMP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|