C19H13ClO — CID 118369172
6-chloro-9-phenyl-2,3-dihydrocyclopenta[b]naphthalen-1-one (PubChem CID 118369172) has the molecular formula C19H13ClO and a molecular weight of 292.77 g/mol. Its IUPAC name is 6-chloro-9-phenyl-2,3-dihydrocyclopenta[b]naphthalen-1-one.
| Compound Name | 6-chloro-9-phenyl-2,3-dihydrocyclopenta[b]naphthalen-1-one |
|---|---|
| PubChem CID | 118369172 |
| Molecular Formula | C19H13ClO |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 6-chloro-9-phenyl-2,3-dihydrocyclopenta[b]naphthalen-1-one |
| SMILES | O=C1CCc2cc3cc(Cl)ccc3c(-c3ccccc3)c21 |
| InChI | InChI=1S/C19H13ClO/c20-15-7-8-16-14(11-15)10-13-6-9-17(21)19(13)18(16)12-4-2-1-3-5-12/h1-5,7-8,10-11H,6,9H2 |
| InChIKey | JRPVADDVFFEKOV-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |