C14H12O2 — CID 15686138
4-methoxy-1,2-dihydrocyclopenta[a]azulen-3-one (PubChem CID 15686138) has the molecular formula C14H12O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is 4-methoxy-1,2-dihydrocyclopenta[a]azulen-3-one.
| Compound Name | 4-methoxy-1,2-dihydrocyclopenta[a]azulen-3-one |
|---|---|
| PubChem CID | 15686138 |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 4-methoxy-1,2-dihydrocyclopenta[a]azulen-3-one |
| SMILES | COc1ccccc2cc3c(c1-2)C(=O)CC3 |
| InChI | InChI=1S/C14H12O2/c1-16-12-5-3-2-4-9-8-10-6-7-11(15)13(10)14(9)12/h2-5,8H,6-7H2,1H3 |
| InChIKey | YEFKIMCGFMPNOD-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |