C26H17Cl2NO — CID 177429085
(2Z)-7-chloro-2-[(4-chlorophenyl)methylidene]-9-phenyl-3,4-dihydroacridin-1-one (PubChem CID 177429085) has the molecular formula C26H17Cl2NO and a molecular weight of 430.33 g/mol. Its IUPAC name is (2Z)-7-chloro-2-[(4-chlorophenyl)methylidene]-9-phenyl-3,4-dihydroacridin-1-one.
| Compound Name | (2Z)-7-chloro-2-[(4-chlorophenyl)methylidene]-9-phenyl-3,4-dihydroacridin-1-one |
|---|---|
| PubChem CID | 177429085 |
| Molecular Formula | C26H17Cl2NO |
| Molecular Weight | 430.33 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | (2Z)-7-chloro-2-[(4-chlorophenyl)methylidene]-9-phenyl-3,4-dihydroacridin-1-one |
| SMILES | O=C1/C(=C\c2ccc(Cl)cc2)CCc2nc3ccc(Cl)cc3c(-c3ccccc3)c21 |
| InChI | InChI=1S/C26H17Cl2NO/c27-19-9-6-16(7-10-19)14-18-8-12-23-25(26(18)30)24(17-4-2-1-3-5-17)21-15-20(28)11-13-22(21)29-23/h1-7,9-11,13-15H,8,12H2/b18-14- |
| InChIKey | XYXCRBOCWYNARP-JXAWBTAJSA-N |
| XLogP | 7.42 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.33 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|