C26H18ClNO — CID 177409114
(2Z)-2-benzylidene-7-chloro-9-phenyl-3,4-dihydroacridin-1-one (PubChem CID 177409114) has the molecular formula C26H18ClNO and a molecular weight of 395.89 g/mol. Its IUPAC name is (2Z)-2-benzylidene-7-chloro-9-phenyl-3,4-dihydroacridin-1-one.
| Compound Name | (2Z)-2-benzylidene-7-chloro-9-phenyl-3,4-dihydroacridin-1-one |
|---|---|
| PubChem CID | 177409114 |
| Molecular Formula | C26H18ClNO |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | (2Z)-2-benzylidene-7-chloro-9-phenyl-3,4-dihydroacridin-1-one |
| SMILES | O=C1/C(=C\c2ccccc2)CCc2nc3ccc(Cl)cc3c(-c3ccccc3)c21 |
| InChI | InChI=1S/C26H18ClNO/c27-20-12-14-22-21(16-20)24(18-9-5-2-6-10-18)25-23(28-22)13-11-19(26(25)29)15-17-7-3-1-4-8-17/h1-10,12,14-16H,11,13H2/b19-15- |
| InChIKey | CDYUFGBTKQXESR-CYVLTUHYSA-N |
| XLogP | 6.77 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|