C19H13ClO2 — CID 54496726
3-benzylidene-6-chloro-1,2-dihydrocyclopenta[b]chromen-9-one (PubChem CID 54496726) has the molecular formula C19H13ClO2 and a molecular weight of 308.76 g/mol. Its IUPAC name is 3-benzylidene-6-chloro-1,2-dihydrocyclopenta[b]chromen-9-one.
| Compound Name | 3-benzylidene-6-chloro-1,2-dihydrocyclopenta[b]chromen-9-one |
|---|---|
| PubChem CID | 54496726 |
| Molecular Formula | C19H13ClO2 |
| Molecular Weight | 308.76 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 3-benzylidene-6-chloro-1,2-dihydrocyclopenta[b]chromen-9-one |
| SMILES | O=c1c2c(oc3cc(Cl)ccc13)C(=Cc1ccccc1)CC2 |
| InChI | InChI=1S/C19H13ClO2/c20-14-7-9-15-17(11-14)22-19-13(6-8-16(19)18(15)21)10-12-4-2-1-3-5-12/h1-5,7,9-11H,6,8H2 |
| InChIKey | XZPWGJADJGFAIN-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.76 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |