About 3-benzylidene-6-chloro-1,2-dihydrocyclopenta[b]chromen-9-one
3-benzylidene-6-chloro-1,2-dihydrocyclopenta[b]chromen-9-one (PubChem CID 54496726) has the molecular formula C19H13ClO2
and a molecular weight of 308.76 g/mol. Its IUPAC name is 3-benzylidene-6-chloro-1,2-dihydrocyclopenta[b]chromen-9-one.
Molecular Properties
| Compound Name | 3-benzylidene-6-chloro-1,2-dihydrocyclopenta[b]chromen-9-one |
| PubChem CID | 54496726 |
| Molecular Formula | C19H13ClO2 |
| Molecular Weight | 308.76 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 3-benzylidene-6-chloro-1,2-dihydrocyclopenta[b]chromen-9-one |
| SMILES | O=c1c2c(oc3cc(Cl)ccc13)C(=Cc1ccccc1)CC2 |
| InChI | InChI=1S/C19H13ClO2/c20-14-7-9-15-17(11-14)22-19-13(6-8-16(19)18(15)21)10-12-4-2-1-3-5-12/h1-5,7,9-11H,6,8H2 |
| InChIKey | XZPWGJADJGFAIN-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.76 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-benzylidene-6-chloro-1,2-dihydrocyclopenta[b]chromen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzylidene-6-chloro-1,2-dihydrocyclopenta[b]chromen-9-one?
The IUPAC name of 3-benzylidene-6-chloro-1,2-dihydrocyclopenta[b]chromen-9-one (CID 54496726) is 3-benzylidene-6-chloro-1,2-dihydrocyclopenta[b]chromen-9-one.
What is the SMILES notation for 3-benzylidene-6-chloro-1,2-dihydrocyclopenta[b]chromen-9-one?
The canonical SMILES for 3-benzylidene-6-chloro-1,2-dihydrocyclopenta[b]chromen-9-one is O=c1c2c(oc3cc(Cl)ccc13)C(=Cc1ccccc1)CC2.
What is the InChIKey of 3-benzylidene-6-chloro-1,2-dihydrocyclopenta[b]chromen-9-one?
The InChIKey is XZPWGJADJGFAIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13ClO2/c20-14-7-9-15-17(11-14)22-19-13(6-8-16(19)18(15)21)10-12-4-2-1-3-5-12/h1-5,7,9-11H,6,8H2.
What are the key properties of 3-benzylidene-6-chloro-1,2-dihydrocyclopenta[b]chromen-9-one?
3-benzylidene-6-chloro-1,2-dihydrocyclopenta[b]chromen-9-one has a molecular weight of 308.76 g/mol, XLogP of 4.93, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzylidene-6-chloro-1,2-dihydrocyclopenta[b]chromen-9-one is sourced from PubChem (CID 54496726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).