C21H14ClNO5 — CID 54407358
2-[[3-[(3-chlorophenyl)methylidene]-9-oxo-1,2-dihydrocyclopenta[b]chromen-6-yl]amino]-2-oxoacetic acid (PubChem CID 54407358) has the molecular formula C21H14ClNO5 and a molecular weight of 395.80 g/mol. Its IUPAC name is 2-[[3-[(3-chlorophenyl)methylidene]-9-oxo-1,2-dihydrocyclopenta[b]chromen-6-yl]amino]-2-oxoacetic acid.
| Compound Name | 2-[[3-[(3-chlorophenyl)methylidene]-9-oxo-1,2-dihydrocyclopenta[b]chromen-6-yl]amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 54407358 |
| Molecular Formula | C21H14ClNO5 |
| Molecular Weight | 395.80 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 2-[[3-[(3-chlorophenyl)methylidene]-9-oxo-1,2-dihydrocyclopenta[b]chromen-6-yl]amino]-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)Nc1ccc2c(=O)c3c(oc2c1)C(=Cc1cccc(Cl)c1)CC3 |
| InChI | InChI=1S/C21H14ClNO5/c22-13-3-1-2-11(9-13)8-12-4-6-16-18(24)15-7-5-14(23-20(25)21(26)27)10-17(15)28-19(12)16/h1-3,5,7-10H,4,6H2,(H,23,25)(H,26,27) |
| InChIKey | VRQVDSKLPAOQNC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.80 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|