C19H14ClNO2 — CID 70430967
(3E)-6-amino-3-[(3-chlorophenyl)methylidene]-1,2-dihydrocyclopenta[b]chromen-9-one (PubChem CID 70430967) has the molecular formula C19H14ClNO2 and a molecular weight of 323.78 g/mol. Its IUPAC name is (3E)-6-amino-3-[(3-chlorophenyl)methylidene]-1,2-dihydrocyclopenta[b]chromen-9-one.
| Compound Name | (3E)-6-amino-3-[(3-chlorophenyl)methylidene]-1,2-dihydrocyclopenta[b]chromen-9-one |
|---|---|
| PubChem CID | 70430967 |
| Molecular Formula | C19H14ClNO2 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | (3E)-6-amino-3-[(3-chlorophenyl)methylidene]-1,2-dihydrocyclopenta[b]chromen-9-one |
| SMILES | Nc1ccc2c(=O)c3c(oc2c1)/C(=C/c1cccc(Cl)c1)CC3 |
| InChI | InChI=1S/C19H14ClNO2/c20-13-3-1-2-11(9-13)8-12-4-6-16-18(22)15-7-5-14(21)10-17(15)23-19(12)16/h1-3,5,7-10H,4,6,21H2/b12-8+ |
| InChIKey | OEZPRJLRRGAREC-XYOKQWHBSA-N |
| XLogP | 4.52 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|