C20H15NO4 — CID 54209175
4-[(6-amino-9-oxo-1,2-dihydrocyclopenta[b]chromen-3-ylidene)methyl]benzoic acid (PubChem CID 54209175) has the molecular formula C20H15NO4 and a molecular weight of 333.34 g/mol. Its IUPAC name is 4-[(6-amino-9-oxo-1,2-dihydrocyclopenta[b]chromen-3-ylidene)methyl]benzoic acid.
| Compound Name | 4-[(6-amino-9-oxo-1,2-dihydrocyclopenta[b]chromen-3-ylidene)methyl]benzoic acid |
|---|---|
| PubChem CID | 54209175 |
| Molecular Formula | C20H15NO4 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 4-[(6-amino-9-oxo-1,2-dihydrocyclopenta[b]chromen-3-ylidene)methyl]benzoic acid |
| SMILES | Nc1ccc2c(=O)c3c(oc2c1)C(=Cc1ccc(C(=O)O)cc1)CC3 |
| InChI | InChI=1S/C20H15NO4/c21-14-6-8-15-17(10-14)25-19-13(5-7-16(19)18(15)22)9-11-1-3-12(4-2-11)20(23)24/h1-4,6,8-10H,5,7,21H2,(H,23,24) |
| InChIKey | PUSQUQBKGAQEAS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|