C21H17NO5S — CID 151271783
ethyl 2-oxo-2-[[9-oxo-3-(thiophen-2-ylmethylidene)-1,2-dihydrocyclopenta[b]chromen-6-yl]amino]acetate (PubChem CID 151271783) has the molecular formula C21H17NO5S and a molecular weight of 395.44 g/mol. Its IUPAC name is ethyl 2-oxo-2-[[9-oxo-3-(thiophen-2-ylmethylidene)-1,2-dihydrocyclopenta[b]chromen-6-yl]amino]acetate.
| Compound Name | ethyl 2-oxo-2-[[9-oxo-3-(thiophen-2-ylmethylidene)-1,2-dihydrocyclopenta[b]chromen-6-yl]amino]acetate |
|---|---|
| PubChem CID | 151271783 |
| Molecular Formula | C21H17NO5S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | ethyl 2-oxo-2-[[9-oxo-3-(thiophen-2-ylmethylidene)-1,2-dihydrocyclopenta[b]chromen-6-yl]amino]acetate |
| SMILES | CCOC(=O)C(=O)Nc1ccc2c(=O)c3c(oc2c1)C(=Cc1cccs1)CC3 |
| InChI | InChI=1S/C21H17NO5S/c1-2-26-21(25)20(24)22-13-6-8-15-17(11-13)27-19-12(5-7-16(19)18(15)23)10-14-4-3-9-28-14/h3-4,6,8-11H,2,5,7H2,1H3,(H,22,24) |
| InChIKey | NWNHNPXEPFAXAW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|