C23H19NO6 — CID 54343641
2-[[5-[(2-methoxyphenyl)methylidene]-9-oxo-7,8-dihydro-6H-xanthen-2-yl]amino]-2-oxoacetic acid (PubChem CID 54343641) has the molecular formula C23H19NO6 and a molecular weight of 405.41 g/mol. Its IUPAC name is 2-[[5-[(2-methoxyphenyl)methylidene]-9-oxo-7,8-dihydro-6H-xanthen-2-yl]amino]-2-oxoacetic acid.
| Compound Name | 2-[[5-[(2-methoxyphenyl)methylidene]-9-oxo-7,8-dihydro-6H-xanthen-2-yl]amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 54343641 |
| Molecular Formula | C23H19NO6 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 2-[[5-[(2-methoxyphenyl)methylidene]-9-oxo-7,8-dihydro-6H-xanthen-2-yl]amino]-2-oxoacetic acid |
| SMILES | COc1ccccc1C=C1CCCc2c1oc1ccc(NC(=O)C(=O)O)cc1c2=O |
| InChI | InChI=1S/C23H19NO6/c1-29-18-8-3-2-5-13(18)11-14-6-4-7-16-20(25)17-12-15(24-22(26)23(27)28)9-10-19(17)30-21(14)16/h2-3,5,8-12H,4,6-7H2,1H3,(H,24,26)(H,27,28) |
| InChIKey | UASRWSCIBFKVHH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|