About methyl 4-[(2-methoxyphenyl)methylidene]-11-oxo-2,3-dihydro-1H-pyrido[2,1-b]quinazoline-8-carboxylate
methyl 4-[(2-methoxyphenyl)methylidene]-11-oxo-2,3-dihydro-1H-pyrido[2,1-b]quinazoline-8-carboxylate (PubChem CID 151991831) has the molecular formula C22H20N2O4
and a molecular weight of 376.41 g/mol. Its IUPAC name is methyl 4-[(2-methoxyphenyl)methylidene]-11-oxo-2,3-dihydro-1H-pyrido[2,1-b]quinazoline-8-carboxylate.
Molecular Properties
| Compound Name | methyl 4-[(2-methoxyphenyl)methylidene]-11-oxo-2,3-dihydro-1H-pyrido[2,1-b]quinazoline-8-carboxylate |
| PubChem CID | 151991831 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | methyl 4-[(2-methoxyphenyl)methylidene]-11-oxo-2,3-dihydro-1H-pyrido[2,1-b]quinazoline-8-carboxylate |
| SMILES | COC(=O)c1ccc2nc3c(c(=O)n2c1)CCCC3=Cc1ccccc1OC |
| InChI | InChI=1S/C22H20N2O4/c1-27-18-9-4-3-6-14(18)12-15-7-5-8-17-20(15)23-19-11-10-16(22(26)28-2)13-24(19)21(17)25/h3-4,6,9-13H,5,7-8H2,1-2H3 |
| InChIKey | UEVLPGKLFPGCMW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 4-[(2-methoxyphenyl)methylidene]-11-oxo-2,3-dihydro-1H-pyrido[2,1-b]quinazoline-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(2-methoxyphenyl)methylidene]-11-oxo-2,3-dihydro-1H-pyrido[2,1-b]quinazoline-8-carboxylate?
The IUPAC name of methyl 4-[(2-methoxyphenyl)methylidene]-11-oxo-2,3-dihydro-1H-pyrido[2,1-b]quinazoline-8-carboxylate (CID 151991831) is methyl 4-[(2-methoxyphenyl)methylidene]-11-oxo-2,3-dihydro-1H-pyrido[2,1-b]quinazoline-8-carboxylate.
What is the SMILES notation for methyl 4-[(2-methoxyphenyl)methylidene]-11-oxo-2,3-dihydro-1H-pyrido[2,1-b]quinazoline-8-carboxylate?
The canonical SMILES for methyl 4-[(2-methoxyphenyl)methylidene]-11-oxo-2,3-dihydro-1H-pyrido[2,1-b]quinazoline-8-carboxylate is COC(=O)c1ccc2nc3c(c(=O)n2c1)CCCC3=Cc1ccccc1OC.
What is the InChIKey of methyl 4-[(2-methoxyphenyl)methylidene]-11-oxo-2,3-dihydro-1H-pyrido[2,1-b]quinazoline-8-carboxylate?
The InChIKey is UEVLPGKLFPGCMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N2O4/c1-27-18-9-4-3-6-14(18)12-15-7-5-8-17-20(15)23-19-11-10-16(22(26)28-2)13-24(19)21(17)25/h3-4,6,9-13H,5,7-8H2,1-2H3.
What are the key properties of methyl 4-[(2-methoxyphenyl)methylidene]-11-oxo-2,3-dihydro-1H-pyrido[2,1-b]quinazoline-8-carboxylate?
methyl 4-[(2-methoxyphenyl)methylidene]-11-oxo-2,3-dihydro-1H-pyrido[2,1-b]quinazoline-8-carboxylate has a molecular weight of 376.41 g/mol, XLogP of 3.37, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(2-methoxyphenyl)methylidene]-11-oxo-2,3-dihydro-1H-pyrido[2,1-b]quinazoline-8-carboxylate is sourced from PubChem (CID 151991831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).