C14H10N2O4 — CID 13052286
4-methoxy-11-oxopyrido[2,1-b]quinazoline-8-carboxylic acid (PubChem CID 13052286) has the molecular formula C14H10N2O4 and a molecular weight of 270.24 g/mol. Its IUPAC name is 4-methoxy-11-oxopyrido[2,1-b]quinazoline-8-carboxylic acid.
| Compound Name | 4-methoxy-11-oxopyrido[2,1-b]quinazoline-8-carboxylic acid |
|---|---|
| PubChem CID | 13052286 |
| Molecular Formula | C14H10N2O4 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 4-methoxy-11-oxopyrido[2,1-b]quinazoline-8-carboxylic acid |
| SMILES | COc1cccc2c(=O)n3cc(C(=O)O)ccc3nc12 |
| InChI | InChI=1S/C14H10N2O4/c1-20-10-4-2-3-9-12(10)15-11-6-5-8(14(18)19)7-16(11)13(9)17/h2-7H,1H3,(H,18,19) |
| InChIKey | KRFHRAAUBLAPSM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|