C20H16N2O4 — CID 56631792
6-[(2-methoxyphenyl)methylidene]-2-oxo-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),8,10,12-tetraene-12-carboxylic acid (PubChem CID 56631792) has the molecular formula C20H16N2O4 and a molecular weight of 348.36 g/mol. Its IUPAC name is 6-[(2-methoxyphenyl)methylidene]-2-oxo-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),8,10,12-tetraene-12-carboxylic acid.
| Compound Name | 6-[(2-methoxyphenyl)methylidene]-2-oxo-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),8,10,12-tetraene-12-carboxylic acid |
|---|---|
| PubChem CID | 56631792 |
| Molecular Formula | C20H16N2O4 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 6-[(2-methoxyphenyl)methylidene]-2-oxo-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),8,10,12-tetraene-12-carboxylic acid |
| SMILES | COc1ccccc1C=C1CCc2c1nc1ccc(C(=O)O)cn1c2=O |
| InChI | InChI=1S/C20H16N2O4/c1-26-16-5-3-2-4-12(16)10-13-6-8-15-18(13)21-17-9-7-14(20(24)25)11-22(17)19(15)23/h2-5,7,9-11H,6,8H2,1H3,(H,24,25) |
| InChIKey | ANLQZIGVAWGAEV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |